Molecule image
Summary
| Full name | N6-threonylcarbamoyladenosine |
| Short name | t6A |
| New Nomenclature | 62A |
| RNAMods abbreviation | 6 |
| Enzymes |
Sua5 (Saccharomyces cerevisiae) TsaD (Escherichia coli) |
| Found in phylogeny | Eubacteria, Eukaryota |
| Found in RNA | tRNA |
| SMILES | CC(O)C(N)C(=O)NC(=O)Nc3ncnc2c3ncn2[C@@H]1O[C@H](CO)[C@H](O)C1O |
| SMILES (no stereochemical information) | CC(O)C(N)C(=O)NC(=O)Nc3ncnc2c3ncn2[C@@H]1O[C@H](CO)[C@H](O)C1O |
LC-MS Information
| Sum formula | C15O8N6H20 |
| Monoisotopic mass | 412.1343 |
| Average mass | 412.3598 |
| [M+H]+ | 413.1421 |
| Product ions | 281 |
| Normalized LC elution time * | 1,62 (Kellner 2014) |
| LC elution order/characteristics | between A and m6A (Kellner 2014) |
* normalized to guanosine (G), measured with a RP C-18 column with acetonitrile/ammonium acetate as mobile phase.
LC-MS Publications
| Title | Authors | Journal | Details | ||
|---|---|---|---|---|---|
| Profiling of RNA modifications by multiplexed stable isotope labelling. | Kellner S, Neumann J, Rosenkranz D, Lebedeva S, Ketting RF, Zischler H, Schneider D, Helm M. | Chem Commun (Camb). | [details] | 24567952 | - |
| Quantitative analysis of ribonucleoside modifications in tRNA by HPLC-coupled mass spectrometry. | Su D, Chan CT, Gu C, Lim KS, Chionh YH, McBee ME, Russell BS, Babu IR, Begley TJ, Dedon PC... | Nat Protoc | [details] | 24625781 | - |
3D Molecule representation
Download [.mol file for t6A]
Chemical groups contained
| Type | Subtype |
|---|---|
| aminoacyl group | threonyl |
| other | carbamoyl |
Reactions producing N6-threonylcarbamoyladenosine
| Name |
|---|
| A:t6A |
| ct6A:t6A |
Reactions starting from N6-threonylcarbamoyladenosine
| Name |
|---|
| t6A:m6t6A |
| t6A:ms2t6A |
| t6A:ct6A |
Occurrence in PDB structures
| PDB-ID | chain | residue |
|---|---|---|
| 1feq | A | T6A/37 |
| 1fl8 | A | T6A/37 |
| 1xmo | X | T6A/37 |
| 1xmq | X | T6A/37 |
| 1yfg | T6A/37 | |
| 2g1g | A | T6A/11 |
Last modification of this entry: Oct. 6, 2017