Molecule image
Summary
| Full name | cytidine |
| Short name | C |
| New Nomenclature | C |
| RNAMods abbreviation | C |
| Enzymes | |
| Found in phylogeny | Archaea, Eubacteria, Eukaryota |
| Found in RNA | |
| PubChem ID | 6175 |
| SMILES | C3(OC(CO)C(O)C(O)3)N1C=CC(N)=NC1(=O) |
| SMILES (no stereochemical information) | C3(OC(CO)C(O)C(O)3)N1C=CC(N)=NC1(=O) |
LC-MS Information
| Sum formula | C9O5N3H13 |
| Monoisotopic mass | 243.0855 |
| Average mass | 243.2197 |
| [M+H]+ | 244.0933 |
| Product ions | 112 |
| Normalized LC elution time * | 0.42 |
| LC elution order/characteristics | not available |
* normalized to guanosine (G), measured with a RP C-18 column with acetonitrile/ammonium acetate as mobile phase.
3D Molecule representation
Download [.mol file for C]
Reactions starting from cytidine
| Name |
|---|
| C:k2C |
| C:ac4C |
| C:m3C |
| C:f5C |
| C:Cm |
| C:m4C |
| C:m5C |
| C:hm5C |
| C:s2C |
| C:U |
| C:C+ |
| C:ho5C |
Last modification of this entry: Oct. 10, 2017