Reaction details:
Reaction type level 1: |
N-glycosyl bond hydrolysis |
Reaction type level 2: |
hydrolysis |
Reaction type level 3: |
group removal |
Input group: |
C1=CC(C(C1NCC2=CN(C3=C2C(=O)N=C(N3)N)C4C(C(C(O4)CO)O)O)O)O |
Output group: |
*O |
Introduced group name: |
hydroxyl |
Introduced group type: |
hydroxyl |
Site: |
sugar |
Atom address: |
C1ʹ |
Modification level: |
0 |
Enzymes that catalyse this reaction:
There are no enzymes known for this reaction
|
|

|
Copyright © Genesilico - All rights reserved
If you have any advice or suggestions for corrections or improvements, please contact:
Andrea Cappannini - lp.vog.bcmii@ininnappaca