| Full name | 5-methyluridine-5'-monophosphate | 
| IUPAC name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate | 
| Short name | pm5U | 
| MODOMICS code new | 2000005551U | 
| MODOMICS code | 5551U | 
| Synonyms | 
         
            
                
                5-methyl-5'-O-phosphonatouridine
 
    5-methyl-UMP CHEBI:142797 m(5)UMP TMP(2-)  | 
| Nature of the modified residue | Natural | 
| RNAMods code | T | 
| Residue unique ID | 194 | 
| Found in RNA | Yes | 
| Related nucleosides | 12 | 
| RCSB ligands | 
| Sum formula | C10H12N2O9P | 
| Type of moiety | nucleotide | 
| Degeneracy | not aplicable | 
| SMILES | [C@H]1([n]2cc(C)c(=O)nc2=O)[C@H](O)[C@H](O)[C@@H](COP([O-])([O-])=O)O1 | 
| logP | -1.0731 | 
| TPSA | 169.3 | 
| Number of atoms | 22 | 
| Number of Hydrogen Bond Acceptors 1 (HBA1) | 9 | 
| Number of Hydrogen Bond Acceptors 2 (HBA2) | 10 | 
| Number of Hydrogen Bond Donors (HBD) | 2 | 
| InChI | InChI=1S/C10H14N2O9P/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(21-9)3-20-22(17,18)19/h2,5-7,9,13-14H,3H2,1H3,(H2,17,18,19)/p-2/t5-,6-,7-,9-/m1/s1 | 
| InChIKey | SWDFLKFMJOONJB-JXOAFFINSA-L | 
| Search the molecule in external databases | ChEMBL PubChem Compound Database Ligand Expo WIPO | 
| PubChem CID | |
| PubChem SIDs | 
* Chemical properties calculated with Open Babel - O'Boyle et al. Open Babel: An open chemical toolbox. J Cheminform 3, 33 (2011) (link)
| Dipole Magnitude [D]: | 30.078524145 | 
| Energy [Eh]: | -1516.62399034791 | 
| HOMO [eV]: | -8.5015 | 
| LUMO [eV]: | 0.9768 | 
| Gap [eV]: | 9.4783 | 
| Charges | charge.txt | 
| 2D | .png .mol .mol2 .sdf .pdb .smi | 
| 3D | .mol .mol2 .sdf .pdb | 
| Monoisotopic mass | None | 
| Average mass | 335.184 | 
| [M+H]+ | not available | 
| Product ions | not available | 
| Normalized LC elution time * | not available | 
| LC elution order/characteristics | not available | 
* normalized to guanosine (G), measured with a RP C-18 column with acetonitrile/ammonium acetate as mobile phase.
Last modification of this entry: Sept. 15, 2025