Reaction details:
Reaction type level 1: |
|
Reaction type level 2: |
|
Reaction type level 3: |
|
Input group: |
None |
Output group: |
[O-]P(=O)(O)OC[C@@H]3O[C@H](n2cnc1c2N=C(N)NC1=O)[C@@H](O)[C@H]3O* |
Introduced group name: |
guanylyl |
Introduced group type: |
nucleotide |
Site: |
phosphate |
Atom address: |
None |
Modification level: |
None |
Enzymes that catalyse this reaction:
There are no enzymes known for this reaction
|
|
? Unknown
![Image with reaction](/modomics/static/img/arrow.webp)
|